CAS 675602-97-8

4-(4-Bromo-3-nitrophenyl)-2-thiazolamine

Description:

4-(4-Bromo-3-nitrophenyl)-2-thiazolamine is an organic compound characterized by its thiazole ring and substituted aromatic system. The presence of a bromine atom and a nitro group on the phenyl ring contributes to its unique reactivity and potential applications in medicinal chemistry. The thiazole moiety introduces heteroatoms, enhancing the compound's biological activity and solubility properties. This compound may exhibit various pharmacological effects, making it of interest in drug development and research. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. Additionally, the compound's stability, solubility, and reactivity can be influenced by the substituents on the aromatic ring, making it a candidate for further studies in synthetic chemistry and material science. As with many chemical substances, safety and handling precautions are essential due to the presence of halogen and nitro groups, which can pose health risks. Overall, 4-(4-Bromo-3-nitrophenyl)-2-thiazolamine represents a valuable compound for further exploration in various chemical and biological contexts.

Formula: C₉H₆BrN₃O₂S

InChI: InChI=1S/C9H6BrN3O2S/c10-6-2-1-5(3-8(6)13(14)15)7-4-16-9(11)12-7/h1-4H,(H2,11,12)

InChI key: InChIKey=AELIUOOJSQZFQO-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C=C(C=CC1Br)C=2N=C(N)SC2

Synonyms:

• 2-Thiazolamine, 4-(4-bromo-3-nitrophenyl)-
• 4-(4-Bromo-3-nitrophenyl)-2-thiazolamine

4-(4-Bromo-3-nitro-phenyl)-thiazol-2-ylamine

CAS: 675602-97-8

Formula: C₉H₆BrN₃O₂S

Color and Shape: Solid

Molecular weight: 300.13

Ref: 10-F014099