CymitQuimica logo

CAS 67561-03-9

:

Carbamic acid, (2-oxoethyl)-, phenylmethyl ester

Description:
Carbamic acid, (2-oxoethyl)-, phenylmethyl ester, with the CAS number 67561-03-9, is an organic compound characterized by its ester functional group derived from carbamic acid. This compound features a phenylmethyl (benzyl) group attached to the carbamic acid moiety, which contributes to its chemical properties. It typically appears as a colorless to pale yellow liquid and is soluble in organic solvents. The presence of the 2-oxoethyl group indicates that it contains a carbonyl functional group adjacent to an ethyl chain, which can influence its reactivity and interactions with other chemical species. This compound may exhibit biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. Its stability and reactivity can be affected by environmental conditions such as pH and temperature. As with many carbamates, it may also be subject to hydrolysis, leading to the release of the corresponding amine and carbon dioxide under certain conditions. Safety data should be consulted for handling and potential hazards associated with this compound.
Formula:C10H11NO3
InChI:InChI=1S/C10H11NO3/c12-7-6-11-10(13)14-8-9-4-2-1-3-5-9/h1-5,7H,6,8H2,(H,11,13)
InChI key:QSNONXQMKXTNQH-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)COC(=O)NCC=O
Found 3 products.