CAS 67562-39-4
:1,2,3,4,6,7,8-heptachlorodibenzo[b,d]furan
Description:
1,2,3,4,6,7,8-Heptachlorodibenzo[b,d]furan is a synthetic organic compound belonging to the class of polychlorinated dibenzo-furans (PCDFs), which are known for their environmental persistence and potential toxicity. This compound features a complex structure characterized by multiple chlorine substituents on a dibenzo-furan backbone, contributing to its stability and resistance to degradation. Heptachlorodibenzo[b,d]furan is typically found as a white to off-white solid and is insoluble in water, but soluble in organic solvents. Its chemical properties include a high melting point and low volatility, which can lead to bioaccumulation in living organisms and potential biomagnification in food chains. Due to its toxicological profile, including potential carcinogenic effects and endocrine disruption, it is classified as a persistent organic pollutant (POP). Regulatory measures often restrict its use and release into the environment, highlighting the importance of monitoring and managing such compounds to mitigate their impact on human health and ecosystems.
Formula:C12HCl7O
InChI:InChI=1/C12HCl7O/c13-3-1-2-4-6(15)7(16)8(17)10(19)12(4)20-11(2)9(18)5(3)14/h1H
InChI key:InChIKey=WDMKCPIVJOGHBF-UHFFFAOYSA-N
SMILES:ClC1=C2C=3C(OC2=C(Cl)C(Cl)=C1Cl)=C(Cl)C(Cl)=C(Cl)C3
Synonyms:- 1,2,3,4,6,7,8-Heptachlorodibenzofuran
- 1,2,3,4,6,7,8-HpCDF
- F 131
- HpCDF
- Pcdf 131
- 1,2,3,4,6,7,8-Heptachlorodibenzo[b,d]furan
- dibenzofuran, 1,2,3,4,6,7,8-heptachloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1,2,3,4,6,7,8-Heptachlorodibenzofuran
CAS:Applications A common environmental pollutant
References Aurell, J., et al.: Environ. Sci. Technol., 44, 9431 (2010), Rovira, J., et al.: Arch. Environ. Contam. Toxicol., 60, 372 (2011), Grant, S., et al.: Environ. Sci. Technol., 45, 406 (2011),Formula:C12HCl7OColor and Shape:NeatMolecular weight:409.31

