CymitQuimica logo

CAS 67565-48-4

:

4-(4-Nitrobenzyloxy)benzaldehyde

Description:
4-(4-Nitrobenzyloxy)benzaldehyde, with the CAS number 67565-48-4, is an organic compound characterized by its aromatic structure, which includes a benzaldehyde group and a nitro-substituted benzyloxy moiety. This compound typically appears as a yellow to orange solid and is soluble in organic solvents such as ethanol and dichloromethane, but has limited solubility in water due to its hydrophobic nature. The presence of the nitro group introduces electron-withdrawing characteristics, influencing the compound's reactivity and making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Its functional groups allow for various chemical transformations, including nucleophilic substitutions and reductions. Additionally, 4-(4-Nitrobenzyloxy)benzaldehyde can exhibit biological activity, which may be of interest in medicinal chemistry. Safety precautions should be taken when handling this compound, as nitro compounds can be hazardous. Overall, its unique structural features and reactivity make it a valuable compound in chemical research and applications.
Formula:C14H11NO4
InChI:InChI=1/C14H11NO4/c16-9-11-3-7-14(8-4-11)19-10-12-1-5-13(6-2-12)15(17)18/h1-9H,10H2
InChI key:RIYUFYPNHRLRON-UHFFFAOYSA-N
SMILES:c1cc(ccc1COc1ccc(cc1)C=O)N(=O)=O
Found 3 products.