CAS 67566-02-3
:3-methyl-1-phenyl-1H-pyrazol-5-yl beta-D-glucopyranosiduronic acid
Description:
3-Methyl-1-phenyl-1H-pyrazol-5-yl beta-D-glucopyranosiduronic acid is a complex organic compound characterized by its unique structural features, which include a pyrazole ring, a phenyl group, and a glucopyranosiduronic acid moiety. This compound is notable for its potential biological activity, often explored in pharmaceutical research due to its ability to interact with various biological targets. The presence of the glucopyranosiduronic acid component suggests that it may exhibit properties related to carbohydrate chemistry, such as solubility in water and potential interactions with biological macromolecules. The methyl and phenyl substituents on the pyrazole ring can influence its electronic properties and steric hindrance, which may affect its reactivity and binding affinity in biological systems. Overall, this compound represents a fascinating intersection of heterocyclic chemistry and carbohydrate chemistry, making it a subject of interest in medicinal chemistry and drug development.
Formula:C16H18N2O7
InChI:InChI=1/C16H18N2O7/c1-8-7-10(18(17-8)9-5-3-2-4-6-9)24-16-13(21)11(19)12(20)14(25-16)15(22)23/h2-7,11-14,16,19-21H,1H3,(H,22,23)/t11-,12-,13+,14-,16+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Edaravone O-β-D-glucuronide
CAS:<p>Edaravone O-β-D-glucuronide</p>Color and Shape:SolidMolecular weight:350.32332g/molNorantipyrine glucuronide
CAS:<p>Norantipyrine glucuronide is a drug metabolite of norantipyrine, which is used to treat pain. Norantipyrine glucuronide has been shown to be resistant to cancer and it was found that the uptake of this metabolite was increased in wild-type mice. Norantipyrine glucuronide has been shown to inhibit multidrug resistance protein (MRP) 1 and 2, organic anion transporters (OATs), and breast cancer cells in vitro. In vivo studies have shown that the uptake of norantipyrine glucuronide is increased in proximal tubules of the human liver, which may be due to the inhibition of MRP1, MRP2, OAT1, and OAT3 by this drug.</p>Formula:C16H18N2O7Purity:Min. 95%Molecular weight:350.32 g/molNorantipyrine Glucuronide
CAS:Controlled Product<p>Applications Antipyrine (A697500), a non-steroidal anti-inflammatory drug, is widely utilized as a probe for human oxidative drug metabolism. Antipyrine metabolites are formed by various hepatic cytochrome P450 enzymes. Norantipyrine Glucuronide is a metabolite of Antipyrine.<br>References Akira K et al. Drug Metab Dispos. 2001 Jun;29(6):903-7.Lehmann WD et al. Biomed Mass Spectrom. 1982 Nov;9(11):477-82.Engel G et al. Clin Pharmacol Ther. 1996 Jun;59(6):613-23.<br></p>Formula:C16H18N2O7Color and Shape:NeatMolecular weight:350.323





