CAS 67567-15-1

Diosbulbin G

Description:

Diosbulbin G is a natural compound classified as a sesquiterpene lactone, primarily derived from the plant Dioscorea bulbifera, commonly known as air potato. This compound exhibits a complex molecular structure characterized by a bicyclic framework, which contributes to its biological activity. Diosbulbin G has garnered interest in pharmacological research due to its potential anti-inflammatory, anti-cancer, and anti-microbial properties. Its mechanism of action may involve the modulation of various signaling pathways, although specific details are still under investigation. Additionally, Diosbulbin G is known for its cytotoxic effects on certain cancer cell lines, making it a subject of interest in the development of novel therapeutic agents. The compound's solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in both laboratory and potential clinical applications. As with many natural products, further studies are needed to fully elucidate its pharmacokinetics and therapeutic potential.

Formula: C₁₉H₂₂O₆

InChI: InChI=1S/C19H22O6/c1-19-7-15(9-2-3-23-8-9)25-18(22)13(19)6-14-16-11(17(21)24-14)4-10(20)5-12(16)19/h2-3,8,10-16,20H,4-7H2,1H3

InChI key: InChIKey=GFUMUSWDMNZQDZ-UHFFFAOYSA-N

SMILES: CC12C3C4C(CC1C(=O)OC(C2)C=5C=COC5)OC(=O)C4CC(O)C3

Synonyms:

• 4H,7H-Furo[2′,3′,4′:4,5]naphtho[2,1-c]pyran-4,7-dione, 9-(3-furanyl)dodecahydro-2-hydroxy-10a-methyl-, (2R,3aR,5aS,6aS,9S,10aS,10bR,10cS)-
• NSC 310635
• (2R,3aR,5aS,6aS,9S,10aS,10bR,10cS)-9-(3-Furanyl)dodecahydro-2-hydroxy-10a-methyl-4H,7H-furo[2′,3′,4′:4,5]naphtho[2,1-c]pyran-4,7-dione
• 4H,7H-Furo[2′,3′,4′:4,5]naphtho[2,1-c]pyran-4,7-dione, 9-(3-furanyl)dodecahydro-2-hydroxy-10a-methyl-, [2R-(2α,3aβ,5aβ,6aα,9β,10aβ,10bα,10cβ)]-
• Diosbulbin G

Diosbulbin G

CAS: 67567-15-1

Formula: C₁₉H₂₂O₆

Purity: 97.0%

Molecular weight: 346.3744

Ref: IN-DA00FEPB

Diosbulbin G

CAS: 67567-15-1

Diosbulbin G is a natural product of Dioscorea, Dioscoreaceae.

Formula: C₁₉H₂₂O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 346.379

Ref: TM-TMA0692

Diosbulbin G

CAS: 67567-15-1

Formula: C₁₉H₂₂O₆

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 346.379

Ref: BP-SBP01231

Diosbulbin G

CAS: 67567-15-1

Diosbulbin G is a naturally occurring compound, which is a type of diterpenoid lactone isolated from the plant Dioscorea bulbifera, commonly known as air potato. This plant is a perennial vine native to Africa and Asia. Diosbulbin G exhibits its mode of action primarily through the induction of oxidative stress and apoptosis in cancer cells. It triggers cellular mechanisms that lead to programmed cell death, thereby interfering with the proliferation of malignant cells.

Formula: C₁₉H₂₂O₆

Purity: Min. 95%

Molecular weight: 346.4 g/mol

Ref: 3D-SCA56715