CymitQuimica logo

CAS 67572-43-4

:

{[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl}acetic acid

Description:
The chemical substance known as {[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl}acetic acid, with the CAS number 67572-43-4, is characterized by its unique structural features that include a benzodioxole moiety and an oxadiazole ring, which contribute to its potential biological activity. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of both hydrophilic and hydrophobic groups. The sulfanyl (thioether) functional group may impart specific reactivity, making it a candidate for various chemical transformations. Additionally, the acetic acid component suggests potential acidity, which can influence its behavior in biological systems and chemical reactions. The presence of heteroatoms like nitrogen and sulfur in its structure may also enhance its interaction with biological targets, making it of interest in medicinal chemistry. Overall, this compound's unique combination of functional groups and structural features positions it as a potentially valuable substance in pharmaceutical research and development.
Formula:C11H8N2O5S
InChI:InChI=1/C11H8N2O5S/c14-9(15)4-19-11-13-12-10(18-11)6-1-2-7-8(3-6)17-5-16-7/h1-3H,4-5H2,(H,14,15)
InChI key:ANWYZYDPQJWUFS-UHFFFAOYSA-N
SMILES:C1OC2=C(O1)C=C(C=C2)C3=NN=C(O3)SCC(=O)O
Synonyms:
  • {[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]thio}acetic acid
Found 4 products.