CAS 67576-77-6
:Methyl-2,3,4-tri-O-benzyl-L-fucopyranose
Description:
Methyl-2,3,4-tri-O-benzyl-L-fucopyranose is a glycoside derivative of L-fucose, characterized by the presence of three benzyl groups attached to the hydroxyl positions at the 2, 3, and 4 carbons of the fucopyranose ring, along with a methyl group at the anomeric carbon. This compound is typically a white to off-white solid and is soluble in organic solvents such as dichloromethane and methanol, but less soluble in water due to its hydrophobic benzyl substituents. The presence of the benzyl groups enhances its stability and can influence its reactivity in glycosylation reactions, making it useful in synthetic organic chemistry, particularly in the synthesis of oligosaccharides and glycoproteins. Additionally, the compound may exhibit specific biological activities, although detailed studies on its biological properties may be limited. Its structural features make it a valuable intermediate in carbohydrate chemistry and a subject of interest for researchers studying glycosylation processes.
Formula:C28H32O5
InChI:InChI=1/C28H32O5/c1-21-25(30-18-22-12-6-3-7-13-22)26(31-19-23-14-8-4-9-15-23)27(28(29-2)33-21)32-20-24-16-10-5-11-17-24/h3-17,21,25-28H,18-20H2,1-2H3/t21-,25+,26+,27-,28-/m0/s1
Synonyms:- methyl 2,3,4-tri-O-benzyl-6-deoxy-alpha-L-galactopyranoside
- methyl 2,3,4-tri-O-benzyl-6-deoxy-beta-L-galactopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(3S,4R,5R,6S)-3,4,5-Tris(benzyloxy)-2-methoxy-6-methyltetrahydro-2H-pyran
CAS:Formula:C28H32O5Molecular weight:448.5507Methyl 2,3,4-tri-O-benzyl-L-fucopyranoside
CAS:<p>Methyl 2,3,4-tri-O-benzyl-L-fucopyranoside is a fluorinated sugar that belongs to the category of carbohydrates. This compound is synthesized from D-galactose and 3,4,5-tri-O-benzyl L-fucose by glycosylation with methyl 2,3,4-tri-O-benzyl L-fucopyranoside. The synthetic route starts with an acetic acid esterification of D-galactose with benzaldehyde in the presence of pyridine and triethylamine to yield methyl 2,3,4-triacetoxybenzoate. A reaction with 3,4,5 trihydroxyphenylacetic acid in the presence of pyridine and triethylamine leads to a glycosylation between the two compounds. The resulting product is then subjected to hydrogenolysis using palladium on</p>Formula:C28H32O5Purity:Min. 95%Molecular weight:448.55 g/mol


