CAS 6758-34-5

[5-(trifluoromethyl)-1H-benzimidazol-2-yl]methanol

Description:

[5-(Trifluoromethyl)-1H-benzimidazol-2-yl]methanol, with the CAS number 6758-34-5, is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. The presence of a trifluoromethyl group (-CF3) at the 5-position of the benzimidazole enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The hydroxymethyl group (-CH2OH) at the 2-position contributes to its potential as a reactive site for further chemical modifications. This compound may exhibit various properties such as solubility in organic solvents, depending on the specific functional groups and their interactions. Its unique structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Additionally, the trifluoromethyl group is known to impart stability and metabolic resistance, which can be advantageous in drug design. Overall, [5-(trifluoromethyl)-1H-benzimidazol-2-yl]methanol represents a versatile scaffold for further exploration in chemical and biological research.

Formula: C₉H₇F₃N₂O

InChI: InChI=1/C9H7F3N2O/c10-9(11,12)5-1-2-6-7(3-5)14-8(4-15)13-6/h1-3,15H,4H2,(H,13,14)

SMILES: c1cc2c(cc1C(F)(F)F)[nH]c(CO)n2

Synonyms:

• 1H-benzimidazole-2-methanol, 5-(trifluoromethyl)-
• [5-(Trifluoromethyl)-1H-benzimidazol-2-yl]methanol

2-(HYDROXYMETHYL)-5-TRIFLUOROMETHYL-1H-BENZOIMIDAZOLE

CAS: 6758-34-5

Formula: C₉H₇F₃N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 216.1599

Ref: IN-DA005M8W

2-(Hydroxymethyl)-5-(trifluoromethyl)benzimidazole

CAS: 6758-34-5

2-(Hydroxymethyl)-5-(trifluoromethyl)benzimidazole

Purity: 95%

Molecular weight: 216.16g/mol

Ref: 54-PC510256

(5-(Trifluoromethyl)-1H-benzo[d]imidazol-2-yl)methanol

CAS: 6758-34-5

Formula: C₉H₇F₃N₂O

Purity: 97%

Molecular weight: 216.163

Ref: 10-F237456