CAS 6758-51-6
:3-(beta-D-glucopyranosyloxy)-5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside
Description:
The chemical substance known as 3-(beta-D-glucopyranosyloxy)-5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside, with the CAS number 6758-51-6, is a glycosylated flavonoid derivative. This compound features a chromen-4-one core structure, which is characteristic of flavonoids, and is substituted with two beta-D-glucopyranosyl groups, enhancing its solubility and potential bioactivity. The presence of hydroxyl groups contributes to its antioxidant properties, while the methoxy and phenolic groups may influence its interaction with biological systems, potentially affecting its pharmacological activities. This compound is of interest in the field of natural products and medicinal chemistry due to its potential health benefits, including anti-inflammatory and antioxidant effects. Its structural complexity suggests that it may exhibit a range of biological activities, making it a candidate for further research in therapeutic applications.
Formula:C28H32O17
InChI:InChI=1/C28H32O17/c1-40-13-4-9(2-3-11(13)31)25-26(45-28-24(39)22(37)19(34)16(8-30)44-28)20(35)17-12(32)5-10(6-14(17)42-25)41-27-23(38)21(36)18(33)15(7-29)43-27/h2-6,15-16,18-19,21-24,27-34,36-39H,7-8H2,1H3/t15-,16-,18-,19-,21+,22+,23-,24-,27-,28+/m1/s1
Synonyms:- 3-(beta-D-glucopyranosyloxy)-5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxo-4H-chromen-7-yl rel-beta-D-glucopyranoside
- 4H-1-benzopyran-4-one, 3,7-bis(beta-D-glucopyranosyloxy)-5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-
- 3-(beta-D-Glucopyranosyloxy)-5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside
- Isorhamnetin 3,7-O-diglucoside
- Isorhamnetin 3,7-O-di-β-D-glucopyranoside
- Isorhamnetin-3,7-O-β-diglucopyranoside
- Isorhamnetin 3,7-di-O-β-D-glucopyranoside
- isorhamnetin 3,7-O-di-β-D-glucopyranoside
- Isorhamnetin-3,7-diglucoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Isorhamnetin 3,7-di-O-β-D-glucopyranoside
CAS:Isorhamnetin 3,7-O-diglucoside may have antioxidant activity.Formula:C28H32O17Purity:98%Color and Shape:SolidMolecular weight:640.54Isorhamnetin 3,7-o-diglucoside
CAS:Isorhamnetin 3,7-o-diglucoside is a flavonoid glucoside compound, which is typically derived from various plant sources such as fruits, vegetables, and medicinal herbs. It is a derivative of isorhamnetin, itself a methylated form of quercetin, known for its bioactive properties. This compound is primarily extracted from plants that have evolved to incorporate complex flavonoids as part of their natural defense mechanisms against environmental stressors.Formula:C28H32O17Purity:Min. 95%Color and Shape:PowderMolecular weight:640.50 g/mol


