CAS 67588-18-5
:2-hydroxy-3-(3-oxo-1-phenylbut-1-en-1-yl)-4H-chromen-4-one
Description:
2-Hydroxy-3-(3-oxo-1-phenylbut-1-en-1-yl)-4H-chromen-4-one, also known by its CAS number 67588-18-5, is a synthetic organic compound belonging to the class of flavonoids. This compound features a chromone backbone, characterized by a benzopyran structure, which is fused with a phenyl group and a ketone functional group. The presence of a hydroxyl group at the 2-position and a conjugated enone system contributes to its potential biological activity, including antioxidant and anti-inflammatory properties. The compound's structure suggests it may exhibit interactions with various biological targets, making it of interest in medicinal chemistry and pharmacology. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its application in research and potential therapeutic uses. Overall, 2-hydroxy-3-(3-oxo-1-phenylbut-1-en-1-yl)-4H-chromen-4-one represents a complex molecule with diverse chemical properties and potential applications in various fields.
Formula:C19H14O4
InChI:InChI=1/C19H14O4/c1-12(20)11-15(13-7-3-2-4-8-13)17-18(21)14-9-5-6-10-16(14)23-19(17)22/h2-11,22H,1H3
SMILES:CC(=O)C=C(c1ccccc1)c1c(=O)c2ccccc2oc1O
Synonyms:- Warfarin RC25
- 2H-1-Benzopyran-2-one, 4-hydroxy-3-(3-oxo-1-phenyl-1-buten-1-yl)-
- NSC 289346
- 4-Hydroxy-3-(3-oxo-1-phenyl-1-buten-1-yl)-2H-1-benzopyran-2-one
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Dehydro Warfarin
CAS:<p>Dehydro warfarin is a metabolite of (±)-warfarin .1It is formed from (±)-warfarin by rat liver microsomes.</p>Formula:C19H14O4Color and Shape:SolidMolecular weight:306.317
