CAS 675882-71-0

3-Amino-4-butyrylamino-5-methylbenzoic acid methyl ester

Description:

3-Amino-4-butyrylamino-5-methylbenzoic acid methyl ester, with the CAS number 675882-71-0, is an organic compound characterized by its complex structure, which includes an amino group, a butyrylamino group, and a methyl ester functional group attached to a benzoic acid core. This compound typically exhibits properties associated with both amines and esters, such as potential solubility in polar solvents and the ability to participate in various chemical reactions, including acylation and esterification. The presence of the amino group suggests that it may engage in hydrogen bonding, influencing its reactivity and interaction with biological systems. Additionally, the methyl ester moiety can enhance lipophilicity, potentially affecting its pharmacokinetic properties if considered for pharmaceutical applications. Overall, this compound's unique functional groups contribute to its potential utility in medicinal chemistry and as a building block for more complex molecules. However, specific physical properties such as melting point, boiling point, and solubility would require empirical measurement or literature reference for precise characterization.

Formula: C₁₃H₁₈N₂O₃

InChI: InChI=1S/C13H18N2O3/c1-4-5-11(16)15-12-8(2)6-9(7-10(12)14)13(17)18-3/h6-7H,4-5,14H2,1-3H3,(H,15,16)

InChI key: InChIKey=UITANFWKOFOWHF-UHFFFAOYSA-N

SMILES: N(C(CCC)=O)C1=C(C)C=C(C(OC)=O)C=C1N

Synonyms:

• 3-Amino-4-butyrylamino-5-methylbenzoic acid methyl ester
• 3-Amino-5-methyl-4-[(1-oxobutyl)amino]-benzoic acid methyl ester
• Benzoic acid,3-amino-5-methyl-4-[(1-oxobutyl)amino]-, methyl ester
• Methyl 3-Amino-4-(Butanoylamino)-5-Methylbenzoate
• Methyl 3-amino-4-butanamido-5-methylbenzoate
• Methyl-4-(butyrylamino)-3-methyl-5-aminobenzoate

Methyl 3-amino-4-butanamido-5-methylbenzoate

CAS: 675882-71-0

Formula: C₁₃H₁₈N₂O₃

Purity: %

Color and Shape: Solid

Molecular weight: 250.2936

Ref: IN-DA005ZER

Methyl 3-amino-4-butanamido-5-methylbenzoate

CAS: 675882-71-0

Methyl 3-amino-4-butanamido-5-methylbenzoate

Purity: 95+%

Ref: 54-OR1042082

Methyl 3-amino-4-butanamido-5-methylbenzoate

CAS: 675882-71-0

Purity: 95+%

Molecular weight: 250.2980042

Ref: 10-F660963

Methyl 3-amino-4-butanamido-5-methylbenzoate

CAS: 675882-71-0

Methyl 3-amino-4-butanamido-5-methylbenzoate is a chemical compound that has been used as a pharmacological agent. It has an affinity for acidic sites on muscle and blocks angiotensin II, which causes vasodilatation of blood vessels, increases blood flow to the heart, and lowers blood pressure. Methyl 3-amino-4-butanamido-5-methylbenzoate is also a strong blocker of angiotensin receptors in the brain. This drug is usually administered in the form of its hydrochloride salt. The physicochemical properties of this compound are determined by elemental analysis and chromatographic methods. Methyl 3-amino-4-butanamido-5-methylbenzoate can be synthesized from 4-(dimethylamino) butyric acid and methyl 3-(aminomethyl) benzoate through the following reaction:

Formula: C₁₃H₁₈N₂O₃

Purity: Min. 95%

Molecular weight: 250.29 g/mol

Ref: 3D-ACB88271

Telmisartan Impurity 8

CAS: 675882-71-0

Formula: C₁₃H₁₈N₂O₃

Molecular weight: 250.30

Ref: ST-EA-CP-T4034