CymitQuimica logo

CAS 67589-15-5

:

2'-hydroxy-5'-(trifluoroMethyl)acetophenone

Description:
2'-Hydroxy-5'-(trifluoromethyl)acetophenone, with the CAS number 67589-15-5, is an organic compound characterized by the presence of both a hydroxyl group and a trifluoromethyl group attached to an acetophenone structure. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and acetone, but may have limited solubility in water due to its hydrophobic trifluoromethyl group. The hydroxyl group contributes to its potential as a phenolic compound, which can participate in hydrogen bonding, influencing its reactivity and interaction with other substances. The trifluoromethyl group enhances the compound's lipophilicity and can affect its biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. Additionally, the presence of both functional groups may impart unique properties, such as altered melting and boiling points, as well as specific reactivity patterns in chemical reactions. Overall, this compound's distinctive structure and functional groups make it a subject of interest in synthetic organic chemistry and material science.
Formula:C9H7F3O2
InChI:InChI=1S/C9H7F3O2/c1-5(13)7-4-6(9(10,11)12)2-3-8(7)14/h2-4,14H,1H3
InChI key:BRSHLOIZDJDEPI-UHFFFAOYSA-N
SMILES:CC(=O)C1=C(C=CC(=C1)C(F)(F)F)O
Synonyms:
  • Ethanone, 1-[2-hydroxy-5-(trifluoromethyl)phenyl]-
  • 2-Hydroxy-5-(trifluoromethyl)acetophenone
Found 4 products.