CAS 6759-78-0
:8-Hydroxyquinoline-2-carbonitrile
Description:
8-Hydroxyquinoline-2-carbonitrile, with the CAS number 6759-78-0, is an organic compound characterized by its quinoline structure, which features a hydroxyl group and a cyano group. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and materials science. The presence of the hydroxyl group contributes to its ability to form hydrogen bonds, enhancing its solubility in polar solvents. The cyano group introduces a strong electron-withdrawing characteristic, which can influence the compound's reactivity and stability. 8-Hydroxyquinoline derivatives are often studied for their chelating properties, particularly in coordination chemistry, where they can form complexes with metal ions. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry for potential therapeutic applications. Overall, 8-Hydroxyquinoline-2-carbonitrile is a versatile compound with significant implications in both chemical research and practical applications.
Formula:C10H6N2O
InChI:InChI=1/C10H6N2O/c11-6-8-5-4-7-2-1-3-9(13)10(7)12-8/h1-5,13H
SMILES:c1cc2ccc(C#N)nc2c(c1)O
Synonyms:- 2-Quinolinecarbonitrile, 8-Hydroxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
8-Hydroxyquinoline-2-carbonitrile, 98%
CAS:8-Hydroxyquinoline-2-carbonitrile is a building block for preparing chelating agents. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / itemFormula:C10H6N2OPurity:98%Molecular weight:170.178-Hydroxyquinoline-2-carbonitrile
CAS:Formula:C10H6N2OPurity:98%Color and Shape:SolidMolecular weight:170.16748-Hydroxy-2-quinolinecarbonitrile
CAS:8-Hydroxy-2-quinolinecarbonitrileFormula:C10H6N2OPurity:98%Color and Shape: light yellow crystalline powderMolecular weight:170.17g/mol8-Hydroxy-2-quinolinecarbonitrile
CAS:8-Hydroxy-2-quinolinecarbonitrile is an uncomplexed ligand that can be used for the synthesis of metal complexes. 8-Hydroxy-2-quinolinecarbonitrile is insoluble in most solvents, including water, and has a high melting point. This compound can be synthesized from acetonitrile and primary amines by condensing with formaldehyde. It is not possible to catalyze this reaction, as it does not undergo homolysis or heterolysis reactions. The uncomplexed ligand has been shown to bind to metal ions such as copper and silver. Its diffraction pattern was found to have a polynuclear nature with a number of diffraction peaks within the range of 5–9 Å.Formula:C10H6N2OPurity:Min. 95%Color and Shape:PowderMolecular weight:170.17 g/mol




