CAS 67592-36-3: [2-(3-Cyclohexen-1-yl)ethyl]trimethoxysilane

Description:[2-(3-Cyclohexen-1-yl)ethyl]trimethoxysilane, with the CAS number 67592-36-3, is an organosilicon compound characterized by the presence of a silane functional group attached to a cyclohexene moiety. This compound typically features a trimethoxysilane group, which enhances its reactivity and ability to bond with various substrates, making it useful in applications such as surface modification and adhesion promotion. The cyclohexene ring contributes to its unique chemical properties, including potential reactivity in polymerization and cross-linking reactions. This silane can be utilized in the formulation of coatings, sealants, and composites, where it can improve mechanical properties and durability. Additionally, its structure allows for compatibility with organic materials, facilitating the development of hybrid organic-inorganic systems. Overall, [2-(3-Cyclohexen-1-yl)ethyl]trimethoxysilane is valued for its versatility in enhancing the performance of materials in various industrial applications.

Formula:C₁₁H₂₂O₃Si

InChI:InChI=1S/C11H22O3Si/c1-12-15(13-2,14-3)10-9-11-7-5-4-6-8-11/h4-5,11H,6-10H2,1-3H3

InChI key:InChIKey=LJNFZEBTNPLCMG-UHFFFAOYSA-N

SMILES:O(C)[Si](OC)(OC)CCC1CC=CCC1

Synonyms:
(2-(3-Cyclohexen-1-yl)ethyl)trimethoxysilane
(2-(3-Cyclohexenyl)ethyl)trimethoxysilane
2-(3-Cyclohexenylethyl)trimethoxysilane
Cyclohexene, 4-[2-(trimethoxysilyl)ethyl]-
Sic 2460.0
Silane, (2-(3-cyclohexen-1-yl)ethyl)trimethoxy-
[2-(Cyclohex-3-En-1-Yl)Ethyl](Trimethoxy)Silane

There are currently no products for this CAS.