CAS 67592-40-9

3-hydroxy-2-(4-pyridyl)inden-1-one

Description:

3-Hydroxy-2-(4-pyridyl)inden-1-one, with the CAS number 67592-40-9, is an organic compound characterized by its unique structure, which includes an indene core substituted with a hydroxyl group and a pyridine ring. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents due to the presence of the hydroxyl group. The pyridine moiety contributes to its potential biological activity, as pyridine derivatives are often associated with various pharmacological effects. The compound may also display interesting optical properties, making it a candidate for applications in materials science or medicinal chemistry. Its reactivity can be influenced by the functional groups present, allowing for potential derivatization or interaction with other chemical species. Overall, 3-hydroxy-2-(4-pyridyl)inden-1-one is of interest for its structural features and potential applications in various fields, including drug development and organic synthesis.

Formula: C₁₄H₉NO₂

InChI: InChI=1/C14H9NO2/c16-13-10-3-1-2-4-11(10)14(17)12(13)9-5-7-15-8-6-9/h1-8,16H

SMILES: c1ccc2c(c1)C(=C(c1ccncc1)C2=O)O

3-Hydroxy-2-(pyridin-4-yl)-1H-inden-1-one

CAS: 67592-40-9

3-Hydroxy-2-(pyridin-4-yl)-1H-inden-1-one

Purity: 95%

Molecular weight: 223.23g/mol

Ref: 54-OR1051953

3-Hydroxy-2-(pyridin-4-yl)-1H-inden-1-one

CAS: 67592-40-9

Purity: 95.0%

Molecular weight: 223.2310028076172

Ref: 10-F092761

3-Hydroxy-2-(pyridin-4-yl)inden-1-one

Controlled Product

CAS: 67592-40-9

Applications Intermediate in the preparation of Vatalanib.
References Bold, G., et al.: J. Med. Chem., 43, 3200 (2000),

Formula: C₁₄H₉NO₂

Color and Shape: Neat

Molecular weight: 223.23

Ref: TR-H952820