CAS 67597-26-6

(9Z,11E,13S,15Z)-13-hydroperoxyoctadeca-9,11,15-trienoic acid

Description:

(9Z,11E,13S,15Z)-13-hydroperoxyoctadeca-9,11,15-trienoic acid, commonly known as hydroperoxy linoleic acid, is a hydroperoxide derivative of linoleic acid, an essential fatty acid. This compound features a complex structure characterized by multiple double bonds and a hydroperoxy functional group, which significantly influences its reactivity and biological activity. The presence of the hydroperoxy group makes it a potent oxidizing agent, contributing to its role in various biochemical processes, including lipid peroxidation and signaling pathways. It is involved in the formation of reactive oxygen species and can act as a precursor for bioactive lipids. This compound is typically found in plant oils and is of interest in studies related to oxidative stress, inflammation, and cell signaling. Its unique stereochemistry, indicated by the specific Z and E configurations, plays a crucial role in its interactions with biological systems. Overall, (9Z,11E,13S,15Z)-13-hydroperoxyoctadeca-9,11,15-trienoic acid is significant in both nutrition and biochemistry, particularly in understanding the effects of fatty acids on health.

Formula: C₁₈H₃₀O₄

InChI: InChI=1/C18H30O4/c1-2-3-11-14-17(22-21)15-12-9-7-5-4-6-8-10-13-16-18(19)20/h3,7,9,11-12,15,17,21H,2,4-6,8,10,13-14,16H2,1H3,(H,19,20)/b9-7-,11-3-,15-12+/t17-/m0/s1

13(S)-Hydroperoxy-9(Z),11(E),15(Z)-octadecatrienoic acid

CAS: 67597-26-6

Formula: C18H30O4

Purity: >98%

Color and Shape: In solution, Ethanol

Molecular weight: 310.43

Ref: 48-12-1858

13-HPOT (>85%)

Controlled Product

CAS: 67597-26-6

Formula: C₁₈H₃₀O₄

Color and Shape: Neat

Molecular weight: 310.428

Ref: TR-H671255

13(S)-HpOTrE

CAS: 67597-26-6

13(S)-HpOTrE, a fatty acid from soy LO-2 action on α-linolenic acid, forms in soybeans (9:1 ratio). It generates plant defense signals against pests.

Formula: C₁₈H₃₀O₄

Color and Shape: Solid

Molecular weight: 310.43

Ref: TM-T37394