CAS 676134-73-9

6-Bromo-3,4-dihydro-1H-isochromen-4-amine hydrochloride (1:1)

Description:

6-Bromo-3,4-dihydro-1H-isochromen-4-amine hydrochloride is a chemical compound characterized by its unique structure, which includes a bromine atom and an amine functional group attached to an isochromen derivative. This compound typically appears as a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the hydrochloride salt form. The presence of the bromine substituent can influence its reactivity and biological activity, making it of interest in medicinal chemistry and drug development. The compound may exhibit various pharmacological properties, potentially acting as a precursor or intermediate in the synthesis of more complex molecules. Its specific applications and effects would depend on further studies and research, particularly in the context of its interactions with biological systems. As with many chemical substances, proper handling and safety measures should be observed, given its potential biological activity and the implications of bromine in its structure.

Formula: C₉H₁₁BrClNO

InChI: InChI=1/C9H10BrNO.ClH/c10-7-2-1-6-4-12-5-9(11)8(6)3-7;/h1-3,9H,4-5,11H2;1H

SMILES: c1cc(cc2c1COCC2N)Br.Cl

6-Bromoisochroman-4-amine hydrochloride

CAS: 676134-73-9

Formula: C₉H₁₁BrClNO

Molecular weight: 264.5467

Ref: IN-DA005YWY

6-Bromo-3,4-dihydro-1H-isochromen-4-amine hydrochloride

CAS: 676134-73-9

Formula: C₉H₁₁BrClNO

Purity: 95%

Molecular weight: 264.55

Ref: 10-F093161