CAS 67625-32-5

8-methyl-3-nitroimidazo[1,2-a]pyridine

Description:

8-Methyl-3-nitroimidazo[1,2-a]pyridine is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. The presence of a methyl group at the 8-position and a nitro group at the 3-position enhances its reactivity and solubility in various solvents. This compound is typically a yellow to orange crystalline solid, exhibiting moderate stability under standard conditions. It is known for its potential biological activity, particularly in the field of medicinal chemistry, where it may serve as a lead compound for the development of pharmaceuticals. The nitro group can participate in reduction reactions, making it a target for further chemical modifications. Additionally, its structure allows for various interactions with biological targets, which is of interest in drug design and development. Safety data should be consulted, as nitro compounds can pose health risks, including toxicity and environmental hazards. Overall, 8-methyl-3-nitroimidazo[1,2-a]pyridine represents a significant compound for research in both synthetic and medicinal chemistry.

Formula: C₈H₇N₃O₂

InChI: InChI=1/C8H7N3O2/c1-6-3-2-4-10-7(11(12)13)5-9-8(6)10/h2-5H,1H3

SMILES: Cc1cccn2c(cnc12)N(=O)=O

8-Methyl-3-nitroimidazo[1,2-a]pyridine

CAS: 67625-32-5

8-Methyl-3-nitroimidazo[1,2-a]pyridine

Purity: ≥95%

Molecular weight: 177.16g/mol

Ref: 54-OR450071