CAS 67625-39-2

Imidazo[1,2-a]pyridine, 2,8-dimethyl-

Description:

Imidazo[1,2-a]pyridine, 2,8-dimethyl- is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. This compound features two methyl groups located at the 2 and 8 positions of the imidazo[1,2-a]pyridine structure, influencing its reactivity and solubility. Typically, compounds of this class exhibit biological activity, making them of interest in medicinal chemistry and drug development. The presence of nitrogen atoms in the ring system can enhance hydrogen bonding and coordination with metal ions, which may be relevant in various catalytic and biological processes. Additionally, imidazo[1,2-a]pyridines are known for their potential as ligands in coordination chemistry and their role in the synthesis of pharmaceuticals. The compound's physical properties, such as melting point, boiling point, and solubility, can vary based on its specific structure and substituents, but it generally exhibits moderate polarity due to the nitrogen atoms in the ring. Overall, 2,8-dimethyl-imidazo[1,2-a]pyridine is a compound of significant interest in both synthetic and applied chemistry.

Formula: C₉H₁₀N₂

InChI: InChI=1S/C9H10N2/c1-7-4-3-5-11-6-8(2)10-9(7)11/h3-6H,1-2H3

InChI key: InChIKey=UWMFIGNJJKNQMR-UHFFFAOYSA-N

SMILES: CC=1C=2N(C=C(C)N2)C=CC1

Synonyms:

• 2,8-Dimethylimidazo[1,2-a]pyridine
• Imidazo[1,2-a]pyridine, 2,8-dimethyl-

2,8-Dimethylimidazo[1,2-a]pyridine

CAS: 67625-39-2

Purity: ≥95%

Molecular weight: 146.1929932

Ref: 10-F632782