CAS 6763-47-9
:(3aR,4S,5R,6R,7S,7aS)-hexahydrospiro[1,3-benzodioxole-2,1'-cyclohexane]-4,5,6,7-tetrol
Description:
The chemical substance known as (3aR,4S,5R,6R,7S,7aS)-hexahydrospiro[1,3-benzodioxole-2,1'-cyclohexane]-4,5,6,7-tetrol, with the CAS number 6763-47-9, is a complex organic compound characterized by its unique spirocyclic structure. This compound features a bicyclic system that includes a benzodioxole moiety fused to a cyclohexane ring, contributing to its rigidity and stereochemical complexity. The presence of multiple hydroxyl (-OH) groups indicates that it is a polyol, which can influence its solubility and reactivity. The specific stereochemistry, denoted by the R and S configurations, suggests that the compound may exhibit chiral properties, potentially leading to different biological activities or interactions depending on its orientation. Such compounds are often of interest in medicinal chemistry and natural product synthesis due to their potential therapeutic applications. Additionally, the presence of multiple functional groups may allow for further chemical modifications, enhancing its utility in various chemical reactions or as a precursor in synthetic pathways.
Formula:C12H20O6
InChI:InChI=1/C12H20O6/c13-6-7(14)9(16)11-10(8(6)15)17-12(18-11)4-2-1-3-5-12/h6-11,13-16H,1-5H2/t6-,7-,8+,9+,10-,11+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,2-O-Cyclohexylidene-myo-inositol
CAS:Formula:C12H20O6Color and Shape:SolidMolecular weight:260.28361,2-O-Cyclohexylidene myo-inositol
CAS:1,2-O-Cyclohexylidene myo-inositolPurity:≥95%Molecular weight:260.28g/mol1,2-O-Cyclohexylidene-myo-inositol
CAS:1,2-O-Cyclohexylidene-myo-inositol (CIM) is a fatty acid that has a 6-hydroxyl group. This compound is used in the diagnosis of chemical biology, immunocomplexes and phosphate derivatives. CIM has been shown to bind to iron and form an immunocomplex with it. CIM also binds to phosphate derivatives, which are found in carbohydrate chemistry. The hydroxyl group on CIM can react with chloride ions and form asymmetric synthesis. Growth factors like insulin and other hormones can be synthesized from this compound through the addition of an amine group or phosphate group. CIM also reacts with monoclonal antibodies for use in diagnostic tests for pancreatic lipase.Formula:C12H20O6Purity:Min. 95%Color and Shape:PowderMolecular weight:260.28 g/mol1,2-O-Cyclohexylidene myo-Inositol
CAS:Controlled ProductApplications 1,2-O-Cyclohexylidene myo-Inositol (cas# 6763-47-9) is a compound useful in organic synthesis.
Formula:C12H20O6Color and Shape:Off-WhiteMolecular weight:260.28




