CymitQuimica logo

CAS 676348-24-6

:

4-(3-Bromo-4-fluorophenyl)-2-thiazolamine

Description:
4-(3-Bromo-4-fluorophenyl)-2-thiazolamine is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen. The presence of a bromine and a fluorine atom on the phenyl group contributes to its unique reactivity and potential biological activity. This compound may exhibit properties such as being a potential pharmaceutical intermediate or a candidate for further chemical modifications due to the presence of functional groups that can participate in various chemical reactions. The thiazolamine moiety suggests potential applications in medicinal chemistry, particularly in the development of antimicrobial or anticancer agents. Its molecular structure allows for interactions with biological targets, making it of interest in drug discovery. Additionally, the compound's solubility, stability, and reactivity would depend on the specific conditions under which it is handled, including solvent choice and temperature. As with many chemical substances, safety data and handling precautions should be considered when working with this compound in a laboratory setting.
Formula:C9H6BrFN2S
InChI:InChI=1S/C9H6BrFN2S/c10-6-3-5(1-2-7(6)11)8-4-14-9(12)13-8/h1-4H,(H2,12,13)
InChI key:InChIKey=DUJCJNOITOUHLQ-UHFFFAOYSA-N
SMILES:BrC=1C=C(C=CC1F)C=2N=C(N)SC2
Synonyms:
  • 4-(3-Bromo-4-fluorophenyl)-2-thiazolamine
  • 2-Thiazolamine, 4-(3-bromo-4-fluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.