CAS 676352-86-6
:3-tert-Butyl-6-[(2-ethylhexyl)thio]aniline
Description:
3-tert-Butyl-6-[(2-ethylhexyl)thio]aniline is an organic compound characterized by its complex structure, which includes an aniline moiety substituted with a tert-butyl group and a thioether group derived from 2-ethylhexyl. This compound typically exhibits properties associated with both aromatic amines and thioethers, such as moderate solubility in organic solvents and potential reactivity due to the presence of the amine functional group. The tert-butyl group contributes to steric hindrance, which can influence the compound's reactivity and interactions with other molecules. Additionally, the thioether linkage may impart unique chemical properties, such as increased lipophilicity and potential for participation in various chemical reactions, including nucleophilic substitutions. This compound may find applications in fields such as materials science, organic synthesis, or as an intermediate in the production of other chemical entities. However, specific safety and handling guidelines should be followed due to the potential toxicity associated with aromatic amines.
Formula:C18H31NS
InChI:InChI=1/C18H31NS/c1-6-8-9-14(7-2)13-20-17-11-10-15(12-16(17)19)18(3,4)5/h10-12,14H,6-9,13,19H2,1-5H3
SMILES:CCCCC(CC)CSc1ccc(cc1N)C(C)(C)C
Synonyms:- 5-(1,1-Dimethylethyl)-2-[(2-ethylhexyl)thio]benzenamine
- 5-Tert-Butyl-2-[(2-Ethylhexyl)Sulfanyl]Aniline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.