CAS 67640-14-6
:(2,3,4,5,6-Pentafluorophenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate
Description:
The chemical substance known as (2,3,4,5,6-Pentafluorophenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate, with the CAS number 67640-14-6, is characterized by its complex molecular structure, which includes a pentafluorophenyl group and a cyclopropanecarboxylate moiety. This compound features multiple fluorine atoms, which contribute to its unique electronic properties and potential reactivity. The presence of the dichloroethenyl group suggests that it may exhibit specific reactivity patterns typical of halogenated compounds, such as increased electrophilicity. The cyclopropane ring adds strain to the structure, potentially influencing its stability and reactivity. This compound may be of interest in various fields, including medicinal chemistry and agrochemicals, due to its potential biological activity and applications. Its physical properties, such as solubility and boiling point, would depend on the overall molecular interactions and the presence of functional groups. As with many fluorinated compounds, it may also exhibit unique environmental behavior and persistence.
Formula:C15H11Cl2F5O2
InChI:InChI=1S/C15H11Cl2F5O2/c1-15(2)6(3-7(16)17)8(15)14(23)24-4-5-9(18)11(20)13(22)12(21)10(5)19/h3,6,8H,4H2,1-2H3
InChI key:InChIKey=YATDSXRLIUJOQN-UHFFFAOYSA-N
SMILES:C(=C(Cl)Cl)C1C(C(OCC2=C(F)C(F)=C(F)C(F)=C2F)=O)C1(C)C
Synonyms:- (2,3,4,5,6-Pentafluorophenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate
- Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (2,3,4,5,6-pentafluorophenyl)methyl ester
- Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (pentafluorophenyl)methyl ester
- Pentafluorobenzyl 3-(2,2-Dichloroethenyl)-2,2-Dimethylcyclopropanecarboxylate
- 2,3,4,5,6-Pentafluorobenzyl 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.