CAS 676495-94-6

Piperidine, 3-(4-fluorophenyl)-

Description:

Piperidine, 3-(4-fluorophenyl)- is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. The presence of a 4-fluorophenyl group at the third position of the piperidine ring introduces significant electronic and steric effects, influencing its chemical reactivity and biological activity. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents and may exhibit moderate solubility in water due to the polar nature of the piperidine nitrogen. The fluorine substituent can enhance the lipophilicity and metabolic stability of the compound, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the compound may exhibit various biological activities, including potential effects on the central nervous system, making it a subject of research in neuropharmacology. Safety data should be consulted for handling and exposure guidelines, as with all chemical substances.

Formula: C₁₁H₁₄FN

InChI: InChI=1/C11H14FN/c12-11-5-3-9(4-6-11)10-2-1-7-13-8-10/h3-6,10,13H,1-2,7-8H2

SMILES: C1CC(CNC1)c1ccc(cc1)F

Synonyms:

• 3-(4-Fluorophenyl)Piperidine

3-(4-Fluorophenyl)piperidine

CAS: 676495-94-6

Formula: C₁₁H₁₄FN

Molecular weight: 179.2340

Ref: IN-DA00FAL1

3-(4-Fluorophenyl)piperidine

CAS: 676495-94-6

3-(4-Fluorophenyl)piperidine

Formula: C₁₁H₁₄FN

Purity: 95%

Color and Shape: pale brown solid

Molecular weight: 179.23g/mol

Ref: 54-PC402101