CAS 676500-39-3
:2,3-difluoro-4-hydroxybenzaldehyde
Description:
2,3-Difluoro-4-hydroxybenzaldehyde is an organic compound characterized by the presence of both fluorine and hydroxyl functional groups on a benzaldehyde structure. The compound features a benzene ring substituted with two fluorine atoms at the 2 and 3 positions, and a hydroxyl group at the 4 position, along with an aldehyde functional group. This arrangement contributes to its unique chemical properties, including potential reactivity due to the electron-withdrawing effects of the fluorine atoms, which can influence the compound's acidity and nucleophilicity. The hydroxyl group can participate in hydrogen bonding, enhancing solubility in polar solvents. Additionally, the presence of the aldehyde group makes it susceptible to oxidation and nucleophilic attack. 2,3-Difluoro-4-hydroxybenzaldehyde may find applications in organic synthesis, pharmaceuticals, and materials science, particularly in the development of fluorinated compounds that exhibit specific biological or chemical activities. Its distinct structure and properties make it a subject of interest in various fields of research.
Formula:C7H4F2O2
InChI:InChI=1/C7H4F2O2/c8-6-4(3-10)1-2-5(11)7(6)9/h1-3,11H
SMILES:c1cc(c(c(c1C=O)F)F)O
Synonyms:- Benzaldehyde, 2,3-difluoro-4-hydroxy-
- Vhr Dq Bf Cf
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,3-Difluoro-4-hydroxybenzaldehyde, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C7H4F2O2Purity:98%Color and Shape:Cream or pink, PowderMolecular weight:158.102,3-Difluoro-4-hydroxybenzaldehyde
CAS:Formula:C7H4F2O2Purity:98%Color and Shape:SolidMolecular weight:158.10232,3-Difluoro-4-hydroxybenzaldehyde
CAS:2,3-Difluoro-4-hydroxybenzaldehydeFormula:C7H4F2O2Purity:97%Color and Shape: light beige solidMolecular weight:158.10226g/mol2,3-Difluoro-4-hydroxybenzaldehyde
CAS:Formula:C7H4F2O2Purity:98%Color and Shape:SolidMolecular weight:158.104



