CymitQuimica logo

CAS 67655-93-0

:

Esterastin

Description:
Esterastin, with the CAS number 67655-93-0, is a chemical compound that belongs to the class of esters. Esters are typically formed from the reaction of an alcohol and a carboxylic acid, resulting in a compound characterized by the functional group -COO-. Esterastin is primarily recognized for its application in the field of agriculture, particularly as a pesticide or herbicide. It exhibits properties that allow it to effectively target specific pests while minimizing harm to non-target organisms. The compound is often noted for its relatively low toxicity to mammals, making it a safer alternative in pest management. Additionally, ester compounds like Esterastin can possess distinctive odors and flavors, which may contribute to their use in various formulations. As with many chemical substances, handling and usage guidelines are essential to ensure safety and environmental protection. Overall, Esterastin represents a significant compound within its category, contributing to agricultural practices and pest control strategies.
Formula:C28H46N2O6
InChI:InChI=1S/C28H46N2O6/c1-4-6-8-10-11-12-13-14-15-17-22(35-28(34)24(20-26(29)32)30-21(3)31)19-25-23(27(33)36-25)18-16-9-7-5-2/h11-12,14-15,22-25H,4-10,13,16-20H2,1-3H3,(H2,29,32)(H,30,31)
InChI key:InChIKey=JKNGELGDDBUFHG-UHFFFAOYSA-N
SMILES:C(CCCCC)C1C(CC(OC(C(CC(N)=O)NC(C)=O)=O)CC=CCC=CCCCCC)OC1=O
Synonyms:
  • Esterastin
  • L-Asparagine, N2-acetyl-, 1-[(3-hexyl-4-oxo-2-oxetanyl)methyl]-3,6-dodecadienyl ester, [2S-[2α(1R*,3Z,6Z),3β]]-
  • L-Asparagine, N2-acetyl-, (1S,3Z,6Z)-1-[[(2S,3S)-3-hexyl-4-oxo-2-oxetanyl]methyl]-3,6-dodecadien-1-yl ester
  • L-Asparagine, N2-acetyl-, (1S,3Z,6Z)-1-[[(2S,3S)-3-hexyl-4-oxo-2-oxetanyl]methyl]-3,6-dodecadienyl ester
  • See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.