CAS 67656-29-5

1-methyl-6-methylidene-6,7,8,9-tetrahydrophenanthro[1,2-b]furan-10,11-dione

Description:

1-Methyl-6-methylidene-6,7,8,9-tetrahydrophenanthro[1,2-b]furan-10,11-dione, with the CAS number 67656-29-5, is a complex organic compound characterized by its unique fused ring structure, which includes a phenanthrene core and a furan dione moiety. This compound typically exhibits a range of chemical properties, including potential reactivity due to the presence of carbonyl groups, which can participate in nucleophilic addition reactions. Its structure suggests it may possess interesting optical properties, possibly exhibiting fluorescence or other light-absorbing characteristics. Additionally, the presence of multiple methyl groups can influence its solubility and stability in various solvents. The compound may also have biological significance, as many derivatives of phenanthrene and furan are known for their pharmacological activities. However, specific data regarding its toxicity, environmental impact, and practical applications may require further investigation, as such information is often limited for less common compounds. Overall, this substance represents a fascinating area of study within organic chemistry and materials science.

Formula: C₁₈H₁₄O₃

InChI: InChI=1/C18H14O3/c1-9-4-3-5-12-11(9)6-7-13-15(12)17(20)16(19)14-10(2)8-21-18(13)14/h6-8H,1,3-5H2,2H3

SMILES: C=C1CCCc2c1ccc1c2C(=O)C(=O)c2c(C)coc12

Synonyms:

• 1-Methyl-6-methylene-6,7,8,9-tetrahydrophenanthro[1,2-b]furan-10,11-dione
• Phenanthro(1,2-b)furan-10,11-dione, 6,7,8,9-tetrahydro-1-methyl-6-methylene-

Methylenetanshinquinone

CAS: 67656-29-5

Methylenetanshinquinone shows antiplasmodial and antitrypanosomal activity, it is active against both Trypanosoma brucei rhodesiense and Plasmodium falciparum.

Formula: C₁₈H₁₄O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 278.3

Ref: TM-TN1930