CymitQuimica logo

CAS 676596-61-5

:

ethyl 3-[(4-ethoxy-4-oxo-butanoyl)amino]pyridine-2-carboxylate

Description:
Ethyl 3-[(4-ethoxy-4-oxo-butanoyl)amino]pyridine-2-carboxylate, identified by its CAS number 676596-61-5, is a chemical compound characterized by its complex structure, which includes a pyridine ring, an ethyl ester group, and an amide linkage. This compound typically exhibits properties associated with both pyridine derivatives and carboxylate esters, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups like the carbonyl and amine. The ethoxy group contributes to its solubility and may influence its biological activity. The compound may be of interest in medicinal chemistry, particularly for its potential applications in drug development, as derivatives of pyridine often exhibit various pharmacological properties. Its synthesis and reactivity can be influenced by the presence of the ethyl ester and the amide functionalities, making it a versatile intermediate in organic synthesis. As with many chemical substances, safety data and handling precautions should be considered when working with this compound in a laboratory setting.
Formula:C14H18N2O5
InChI:InChI=1/C14H18N2O5/c1-3-20-12(18)8-7-11(17)16-10-6-5-9-15-13(10)14(19)21-4-2/h5-6,9H,3-4,7-8H2,1-2H3,(H,16,17)
SMILES:CCOC(=O)CCC(=Nc1cccnc1C(=O)OCC)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.