CAS 676596-62-6
:Ethyl 6,7-dihydro-9-hydroxy-6-oxo-5H-pyrido[3,2-b]azepine-8-carboxylate
Description:
Ethyl 6,7-dihydro-9-hydroxy-6-oxo-5H-pyrido[3,2-b]azepine-8-carboxylate is a chemical compound characterized by its complex bicyclic structure, which includes a pyridine and azepine moiety. This compound features a carboxylate ester functional group, contributing to its potential reactivity and solubility properties. The presence of a hydroxyl group indicates potential for hydrogen bonding, which may influence its solubility in polar solvents and its biological activity. The oxo group (carbonyl) enhances the compound's reactivity, making it a candidate for various chemical transformations. Ethyl esters are generally known for their pleasant odors and are often used in flavoring and fragrance applications. Additionally, the specific arrangement of substituents on the bicyclic framework may impart unique pharmacological properties, making it of interest in medicinal chemistry. Overall, this compound's structural features suggest potential applications in drug development, particularly in areas targeting neurological or psychological conditions, although further studies would be necessary to elucidate its specific biological effects and mechanisms of action.
Formula:C12H12N2O4
InChI:InChI=1S/C12H12N2O4/c1-2-18-12(17)7-6-9(15)14-8-4-3-5-13-10(8)11(7)16/h3-5,16H,2,6H2,1H3,(H,14,15)
InChI key:InChIKey=RXKNXEINJYMUOD-UHFFFAOYSA-N
SMILES:OC=1C=2C(NC(=O)CC1C(OCC)=O)=CC=CN2
Synonyms:- 5H-Pyrido[3,2-b]azepine-8-carboxylic acid, 6,7-dihydro-9-hydroxy-6-oxo-, ethyl ester
- Ethyl 6,7-dihydro-9-hydroxy-6-oxo-5H-pyrido[3,2-b]azepine-8-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6,7-Dihydro-9-hydroxy-6-oxo-5H-pyrido[3,2-b]azepine-8-carboxylic Acid Ethyl Ester
CAS:Controlled ProductFormula:C12H12N2O4Color and Shape:NeatMolecular weight:248.23
