CAS 67669-19-6
:N-(2,4-Dichloro-5-hydroxyphenyl)acetamide
Description:
N-(2,4-Dichloro-5-hydroxyphenyl)acetamide, with the CAS number 67669-19-6, is a chemical compound that belongs to the class of acetamides. It is characterized by the presence of a dichlorophenol moiety, which contributes to its biological activity and potential applications in pharmaceuticals. The compound features a hydroxyl group, which enhances its solubility in polar solvents and may influence its reactivity and interaction with biological targets. Typically, compounds of this nature exhibit moderate to high stability under standard conditions, although they may be sensitive to extreme pH or temperature variations. The dichloro substituents can affect the electronic properties of the molecule, potentially impacting its pharmacological profile. N-(2,4-Dichloro-5-hydroxyphenyl)acetamide may be of interest in medicinal chemistry, particularly for its potential therapeutic effects, but specific biological activities would depend on further empirical studies. As with all chemical substances, proper handling and safety protocols should be observed due to potential toxicity or environmental impact.
Formula:C8H7Cl2NO2
InChI:InChI=1S/C8H7Cl2NO2/c1-4(12)11-7-3-8(13)6(10)2-5(7)9/h2-3,13H,1H3,(H,11,12)
InChI key:InChIKey=KKTTWHOBHAIWDY-UHFFFAOYSA-N
SMILES:N(C(C)=O)C1=C(Cl)C=C(Cl)C(O)=C1
Synonyms:- 2',4'-Dichloro-5'-hydroxyacetanilide
- Acetamide, N-(2,4-dichloro-5-hydroxyphenyl)-
- Qr Bg Dg Emv1
- N-(2,4-Dichloro-5-hydroxyphenyl)acetamide
- N-(2,4-Dichloro-5-hydroxyphenyl)acetamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
N-(2,4-Dichloro-5-hydroxyphenyl)acetamide
CAS:Formula:C8H7Cl2NO2Purity:95%Color and Shape:SolidMolecular weight:220.05272,4-Dichloro-5-hydroxyacetanilide
CAS:2,4-Dichloro-5-hydroxyacetanilide is a gaseous compound that has a carboxylic acid and carboxylic functional group. It is produced by the reaction of chlorosulfonyl chloride with an aromatic carboxylic acid in the presence of carbon atoms. 2,4-Dichloro-5-hydroxyacetanilide has been used in the synthesis of sulfonamides, which are organic compounds that contain a sulfonyl group. The chemical has also been used to make herbicides such as atrazine and simazine.
Formula:C8H7Cl2NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:220.05 g/molN-(2,4-Dichloro-5-hydroxyphenyl)acetamide
CAS:Controlled ProductFormula:C8H7Cl2NO2Color and Shape:NeatMolecular weight:220.053N-(2,4-Dichloro-5-hydroxyphenyl)acetamide
CAS:N-(2,4-Dichloro-5-hydroxyphenyl)acetamide is a useful organic compound for research related to life sciences. The catalog number is T65326 and the CAS number is 67669-19-6.Formula:C8H7Cl2NO2Color and Shape:SolidMolecular weight:220.05






