CAS 67676-47-5
:4-[Ethyl(phenylmethyl)amino]benzaldehyde
Description:
4-[Ethyl(phenylmethyl)amino]benzaldehyde, with the CAS number 67676-47-5, is an organic compound that features a benzaldehyde functional group substituted with an ethyl and a phenylmethyl amino group. This compound typically appears as a solid or liquid, depending on the specific conditions, and is characterized by its aromatic structure, which contributes to its chemical reactivity and potential applications in organic synthesis. The presence of the aldehyde group indicates that it can participate in various chemical reactions, such as nucleophilic addition and condensation reactions. Additionally, the ethyl and phenylmethyl substituents can influence the compound's solubility, polarity, and overall reactivity. This compound may be of interest in medicinal chemistry and materials science due to its potential biological activity and utility in synthesizing more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C16H17NO
InChI:InChI=1S/C16H17NO/c1-2-17(12-14-6-4-3-5-7-14)16-10-8-15(13-18)9-11-16/h3-11,13H,2,12H2,1H3
InChI key:InChIKey=YVBIDCBDRUUGEA-UHFFFAOYSA-N
SMILES:N(CC1=CC=CC=C1)(CC)C2=CC=C(C=O)C=C2
Synonyms:- 4-(Benzyl-ethyl-amino)-benzaldehyde
- 4-(Benzylethylamino)benzaldehyde
- 4-(N-Ethyl-N-Benzyl)Amino-Benzoaldehyde
- 4-[Ethyl(phenylmethyl)amino]benzaldehyde
- 4-[N-Benzyl-N-(ethylamino)]-benzaldehyde
- Benzaldehyde, 4-[ethyl(phenylmethyl)amino]-
- NSC 135484
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery