CAS 67680-56-2
:N-(2-iodoethyl)trifluoroacetamide
Description:
N-(2-Iodoethyl)trifluoroacetamide is an organic compound characterized by the presence of a trifluoroacetamide functional group and an iodoethyl substituent. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The compound features a carbon chain with an iodine atom attached to the second carbon, which contributes to its reactivity and potential applications in organic synthesis. The trifluoroacetamide moiety enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of the trifluoromethyl group imparts unique properties such as increased lipophilicity and thermal stability. N-(2-Iodoethyl)trifluoroacetamide is often utilized in medicinal chemistry and material science for the development of pharmaceuticals and advanced materials. However, due to the presence of iodine, it may pose certain health and environmental risks, necessitating careful handling and disposal in laboratory settings.
Formula:C4H5F3INO
InChI:InChI=1/C4H5F3INO/c5-4(6,7)3(10)9-2-1-8/h1-2H2,(H,9,10)
SMILES:C(CN=C(C(F)(F)F)O)I
Synonyms:- 2,2,2-trifluoro-N-(2-iodoethyl)acetamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
N-(Iodoethyl)trifluoroacetamide
CAS:N-(Iodoethyl)trifluoroacetamide
Formula:C4H5F3INOPurity:>95% (gc) (Typical Value in Batch COA)Color and Shape: white plateletsMolecular weight:266.99g/molN-[2-Iodoethyl]trifluoroacetamide
CAS:N-[2-Iodoethyl]trifluoroacetamide is a reactive alkylating agent that is used in the synthesis of biologically active molecules. It reacts with lysines, tryptic and other amino acids to form covalent bonds, which can be cleaved by hydrolysis. The compound also reacts with sulfhydryl groups to produce sulfonium ions, which react with the thiol group at position C6 on the sarcoplasmic reticulum Ca2+ -ATPase to inhibit muscle contraction. N-[2-Iodoethyl]trifluoroacetamide has been shown to cause allergic reactions in rats, mice, and guinea pigs. This drug has also been observed to have an effect on the central nervous system when administered at high doses.Formula:C4H5NOIF3Purity:Min. 95%Color and Shape:PowderMolecular weight:266.99 g/mol

