CAS 67686-02-6

4-Piperidinemethanol, 1-(2-phenylethyl)-

Description:

4-Piperidinemethanol, 1-(2-phenylethyl)-, also known by its CAS number 67686-02-6, is an organic compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a hydroxymethyl group (-CH2OH) attached to the piperidine ring, as well as a phenylethyl substituent, which contributes to its potential biological activity. The presence of both the piperidine and phenylethyl groups suggests that this compound may exhibit interesting pharmacological properties, possibly acting as a neurotransmitter modulator or having other effects on the central nervous system. Its solubility and reactivity can be influenced by the functional groups present, making it relevant in medicinal chemistry and drug development. Additionally, the compound's structure may allow for various synthetic modifications, enhancing its utility in research and potential therapeutic applications. As with many organic compounds, safety and handling precautions should be observed due to the potential for toxicity or reactivity.

Formula: C₁₄H₂₁NO

InChI: InChI=1S/C14H21NO/c16-12-14-7-10-15(11-8-14)9-6-13-4-2-1-3-5-13/h1-5,14,16H,6-12H2

InChI key: InChIKey=GBSSHKIMVABZLJ-UHFFFAOYSA-N

SMILES: C(CC1=CC=CC=C1)N2CCC(CO)CC2

Synonyms:

• 1-(2-Phenylethyl)-4-Piperidinemethanol
• 4-Piperidinemethanol, 1-(2-phenylethyl)-
• 4-Piperidinemethanol, 1-phenethyl-
• [1-(2-Phenylethyl)piperidin-4-yl]methanol

[1-(2-phenylethyl)piperidin-4-yl]methanol

CAS: 67686-02-6

Formula: C₁₄H₂₁NO

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 219.328

Ref: 10-F308907