
CAS 67715-79-1
:4,6,9-Trimethyl-3,5,8,10-tetraoxadodecane
Description:
4,6,9-Trimethyl-3,5,8,10-tetraoxadodecane, with the CAS number 67715-79-1, is a synthetic organic compound characterized by its unique structure featuring multiple ether linkages and a long carbon chain. This compound contains four oxygen atoms integrated into its dodecane backbone, contributing to its potential solubility in polar solvents. The presence of trimethyl groups at specific positions enhances its steric properties and may influence its reactivity and interaction with other molecules. Typically, compounds of this nature can exhibit properties such as low volatility and moderate thermal stability, making them suitable for various applications, including as surfactants or in polymer formulations. The tetraoxadodecane structure suggests potential uses in fields like materials science and pharmaceuticals, where specific functional characteristics are desired. However, detailed studies on its toxicity, environmental impact, and specific applications would be necessary to fully understand its practical implications and safety profile.
Formula:C11H24O4
InChI:InChI=1S/C11H24O4/c1-6-12-10(4)14-8-9(3)15-11(5)13-7-2/h9-11H,6-8H2,1-5H3
InChI key:InChIKey=TZVJNJVDGXFMCF-UHFFFAOYSA-N
SMILES:C(COC(OCC)C)(OC(OCC)C)C
Synonyms:- 3,5,8,10-Tetraoxadodecane, 4,6,9-trimethyl-
- 1,2-Di(1-ethoxyethoxy)propane
- 4,6,9-Trimethyl-3,5,8,10-tetraoxadodecane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.