CAS 67715-80-4
:2-Methyl-4-n-propyl-1,3-oxathiane
Description:
2-Methyl-4-n-propyl-1,3-oxathiane is a heterocyclic organic compound characterized by a six-membered ring containing both sulfur and oxygen atoms. The structure features a thiane ring, which is a saturated cyclic compound with a sulfur atom, and it includes two alkyl substituents: a methyl group and a propyl group. This compound is typically colorless to pale yellow in appearance and may possess a distinctive odor, often associated with sulfur-containing compounds. Its molecular structure contributes to its potential applications in various fields, including fragrance and flavor industries, as well as in organic synthesis. The presence of the oxathiane ring suggests that it may exhibit unique chemical reactivity, particularly in nucleophilic substitution reactions. Additionally, the compound's physical properties, such as boiling point and solubility, can vary based on the specific conditions and purity. Safety data should be consulted for handling and storage, as compounds containing sulfur can sometimes pose health risks. Overall, 2-Methyl-4-n-propyl-1,3-oxathiane is an interesting compound with potential utility in both industrial and research applications.
Formula:C8H16OS
InChI:InChI=1S/C8H16OS/c1-3-4-8-5-6-9-7(2)10-8/h7-8H,3-6H2,1-2H3
InChI key:InChIKey=GKGOLPMYJJXRGD-UHFFFAOYSA-N
SMILES:C(CC)C1SC(C)OCC1
Synonyms:- 1,3-Oxathiane, 2-methyl-4-propyl-
- 2-Methyl-4-propyl-1,3-oxathiane
- Oxanthia
- Tropathiane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Methyl-4-propyl-1,3-oxathiane (cis- and trans- mixture)
CAS:Formula:C8H16OSPurity:>97.0%(GC)Color and Shape:Colorless to Yellow to Orange clear liquidMolecular weight:160.282-Methyl-4-propyl-1,3-oxathiane
CAS:Formula:C8H16OSPurity:98%Color and Shape:LiquidMolecular weight:160.27702-Methyl-4-propyl-1,3-oxathiane, mixture of cis and trans
CAS:2-Methyl-4-propyl-1,3-oxathiane, mixture of cis and transPurity:98%Molecular weight:160.28g/molTropathiane
CAS:Controlled ProductFormula:C8H16OSColor and Shape:Light YellowMolecular weight:160.2772-Methyl-4-propyl-1,3 oxathiane
CAS:2-Methyl-4-propyl-1,3 oxathiane is a terpene. It has been shown to have significant effects on acetaldehyde levels in the brain and liver after consumption of alcohol. 2-Methyl-4-propyl-1,3 oxathiane is also able to increase the levels of acetaldehyde in blood plasma. It does this by inhibiting an enzyme that breaks down acetaldehyde called alcohol dehydrogenase. This means that alcohol will stay in the system for longer, resulting in higher blood alcohol levels. 2-Methyl-4-propyl-1,3 oxathiane may be used as a biomarker for alcohol consumption. It can be detected by analytical methods such as high performance liquid chromatography (HPLC).Formula:C8H16OSPurity:Min. 95%Color and Shape:Colourless To Light (Or Pale) Yellow Or Pink LiquidMolecular weight:160.28 g/mol2-Methyl-4-propyl-1,3-oxathiane
CAS:Formula:C8H16OSPurity:98% (mixture of cis and trans)Molecular weight:160.28





