CAS 677304-83-5

7-Benzothiazolecarboxylic acid

Description:

7-Benzothiazolecarboxylic acid is an organic compound characterized by its benzothiazole structure, which consists of a benzene ring fused to a thiazole ring. This compound typically exhibits properties such as being a solid at room temperature, with a relatively high melting point due to its aromatic nature. It is often soluble in polar organic solvents, while its solubility in water may be limited. The presence of the carboxylic acid functional group (-COOH) imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the benzothiazole moiety contributes to its potential biological activity, making it of interest in pharmaceutical and agrochemical research. The compound may also exhibit fluorescence, which can be useful in various applications, including sensors and dyes. Overall, 7-benzothiazolecarboxylic acid is a versatile compound with significant implications in both synthetic chemistry and material science.

Formula: C₈H₅NO₂S

InChI: InChI=1S/C8H5NO2S/c10-8(11)5-2-1-3-6-7(5)12-4-9-6/h1-4H,(H,10,11)

InChI key: InChIKey=ORSZGLLQNYSMNO-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(N=CS2)=CC=C1

Synonyms:

• 7-Benzothiazolecarboxylic Acid
• 7-Benzothiazolecarboxylicacid
• 1,3-Benzothiazole-7-carboxylic acid

Benzo[d]thiazole-7-carboxylic acid

CAS: 677304-83-5

Formula: C₈H₅NO₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 179.19

Ref: 10-F077554

1,3-Benzothiazole-7-carboxylic acid

CAS: 677304-83-5

1,3-Benzothiazole-7-carboxylic acid

Purity: 96%

Molecular weight: 179.20g/mol

Ref: 54-OR305043

7-Benzothiazolecarboxylic Acid

CAS: 677304-83-5

Applications 7-Benzothiazolecarboxylic Acid is an intermediate used in the synthesis of pyrazole inhibitors of coactivator associated arginine methyltransferase 1 (CARM1). It is also used to prepare aminofuro-pyridine derivatives as inhibitors of TAK1.
References Huynh, T., et al.: Bioorg. Med. Chem. Lett., 19, 2924 (2009); Horneberger, K., et al.: Bioorg. Med. Chem. Lett., 23, 4517 (2013)

Formula: C₈H₅NO₂S

Color and Shape: Neat

Molecular weight: 179.196

Ref: TR-B200050