CAS 677304-89-1

ethyl 2-amino-1,3-benzothiazole-7-carboxylate

Description:

Ethyl 2-amino-1,3-benzothiazole-7-carboxylate is a chemical compound characterized by its unique structure, which includes a benzothiazole ring fused with an amino group and a carboxylate ester. This compound typically exhibits properties associated with both the benzothiazole moiety and the carboxylate functional group, such as moderate solubility in polar solvents and potential reactivity due to the presence of the amino group. The benzothiazole structure often imparts biological activity, making such compounds of interest in medicinal chemistry and drug development. Ethyl 2-amino-1,3-benzothiazole-7-carboxylate may also participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, due to the functional groups present. Its CAS number, 677304-89-1, allows for easy identification in chemical databases and literature. Overall, this compound's characteristics suggest potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis.

Formula: C₁₀H₁₀N₂O₂S

InChI: InChI=1/C10H10N2O2S/c1-2-14-9(13)6-4-3-5-7-8(6)15-10(11)12-7/h3-5H,2H2,1H3,(H2,11,12)

SMILES: CCOC(=O)c1cccc2c1sc(=N)[nH]2

Synonyms:

• 7-Benzothiazolecarboxylic Acid, 2-Amino-, Ethyl Ester
• Ethyl 2-amino-1,3-benzothiazole-7-carboxylate
• 2-amino-7-benzothiazolecarboxylic acid ethyl ester
• 7-Benzothiazolecarboxylicacid,2-amino-,ethylester(9CI)
• Ethyl 2-aMinobenzo[d]thiazole-7-carboxylate

7-Benzothiazolecarboxylicacid,2-amino-,ethylester(9CI)

CAS: 677304-89-1

Formula: C₁₀H₁₀N₂O₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 222.2636

Ref: IN-DA00FH38

Ethyl 2-aminobenzo[d]thiazole-7-carboxylate

CAS: 677304-89-1

Ethyl 2-aminobenzo[d]thiazole-7-carboxylate

Purity: 98%

Molecular weight: 222.26g/mol

Ref: 54-OR94401

Ethyl 2-aminobenzo[d]thiazole-7-carboxylate

CAS: 677304-89-1

Formula: C₁₀H₁₀N₂O₂S

Purity: 98%

Molecular weight: 222.26

Ref: 10-F377397