CAS 677326-80-6
:1-[(2-Methyl-1-naphthalenyl)methyl]piperazine
Description:
1-[(2-Methyl-1-naphthalenyl)methyl]piperazine, identified by its CAS number 677326-80-6, is a chemical compound that features a piperazine ring substituted with a 2-methyl-1-naphthyl group. This structure imparts unique characteristics to the compound, including its potential biological activity. The presence of the naphthalene moiety suggests that it may exhibit aromatic properties, contributing to its stability and interaction with other molecules. The piperazine ring is known for its role in various pharmacological applications, often serving as a scaffold in drug design due to its ability to form hydrogen bonds and interact with biological targets. The compound may exhibit lipophilicity due to the naphthalene component, which can influence its solubility and permeability in biological systems. Additionally, the methyl group on the naphthalene ring can affect the steric and electronic properties, potentially impacting its reactivity and interaction with receptors. Overall, this compound may be of interest in medicinal chemistry and pharmacology for its potential therapeutic applications.
Formula:C16H20N2
InChI:InChI=1S/C16H20N2/c1-13-6-7-14-4-2-3-5-15(14)16(13)12-18-10-8-17-9-11-18/h2-7,17H,8-12H2,1H3
InChI key:InChIKey=DFWSIPPWIKEQII-UHFFFAOYSA-N
SMILES:C(C=1C2=C(C=CC1C)C=CC=C2)N3CCNCC3
Synonyms:- Piperazine, 1-[(2-methyl-1-naphthalenyl)methyl]-
- 1-[(2-Methyl-1-naphthalenyl)methyl]piperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
