CAS 67733-52-2
:2,2',3,4,4',5,5'-heptabromobiphenyl
Description:
2,2',3,4,4',5,5'-heptabromobiphenyl, with the CAS number 67733-52-2, is a polybrominated biphenyl (PBB) compound characterized by the presence of seven bromine atoms attached to a biphenyl structure. This compound is part of a larger class of brominated flame retardants, which are used to reduce flammability in various materials. Its molecular structure contributes to its stability and resistance to degradation, making it persistent in the environment. 2,2',3,4,4',5,5'-heptabromobiphenyl is typically found in industrial applications, particularly in plastics and textiles. However, due to its potential toxicity and environmental impact, including bioaccumulation and endocrine disruption, its use has been restricted or banned in several regions. The compound is also subject to regulatory scrutiny, and ongoing research is focused on understanding its health effects and environmental behavior. Proper handling and disposal are essential to mitigate risks associated with exposure to this chemical.
Formula:C12H3Br7
InChI:InChI=1/C12H3Br7/c13-6-3-8(15)7(14)1-4(6)5-2-9(16)11(18)12(19)10(5)17/h1-3H
SMILES:c1c(c2cc(c(c(c2Br)Br)Br)Br)c(cc(c1Br)Br)Br
Synonyms:- 1,1'-Biphenyl, 2,2',3,4,4',5,5'-Heptabromo-
- 2,2',3,4,4',5,5'-Heptabromo-1,1'-biphenyl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
