CAS 67733-57-7

2,3,7,8-Tetrabromodibenzofuran

Description:

2,3,7,8-Tetrabromodibenzofuran (CAS 67733-57-7) is a polybrominated dibenzofuran, a class of compounds known for their environmental persistence and potential toxicity. This substance is characterized by the presence of four bromine atoms substituted at the 2, 3, 7, and 8 positions of the dibenzofuran structure, which contributes to its stability and lipophilicity. It is typically found as a white to off-white solid and is insoluble in water but soluble in organic solvents. Due to its brominated nature, it exhibits flame-retardant properties, making it of interest in various industrial applications. However, 2,3,7,8-Tetrabromodibenzofuran is also associated with environmental concerns, as it can bioaccumulate in living organisms and has been linked to adverse health effects, including endocrine disruption and potential carcinogenicity. Regulatory scrutiny surrounding such compounds has increased, leading to restrictions on their use and the need for careful management in waste disposal and environmental monitoring.

Formula: C₁₂H₄Br₄O

InChI: InChI=1S/C12H4Br4O/c13-7-1-5-6-2-8(14)10(16)4-12(6)17-11(5)3-9(7)15/h1-4H

InChI key: InChIKey=HCSRVQXNLHZQNM-UHFFFAOYSA-N

SMILES: BrC=1C=C2C=3C(OC2=CC1Br)=CC(Br)=C(Br)C3

Synonyms:

• 2,3,7,8-Tetrabromodibenzofuran
• Dibenzofuran, 2,3,7,8-Tetrabromo-
• 2,3,7,8-Tetrabromodibenzo[b,d]furan