CymitQuimica logo

CAS 6775-25-3

:

1-(3,6-dihydropyridin-1(2H)-yl)-3-(2-methylphenoxy)propan-2-ol hydrochloride (1:1)

Description:
1-(3,6-Dihydropyridin-1(2H)-yl)-3-(2-methylphenoxy)propan-2-ol hydrochloride is a chemical compound characterized by its complex structure, which includes a dihydropyridine moiety and a phenoxy group. This substance typically exhibits properties associated with both its hydrophilic and lipophilic components, making it soluble in various organic solvents and potentially in water, depending on the pH. The presence of the hydrochloride salt form enhances its solubility and stability. As a dihydropyridine derivative, it may exhibit biological activity, potentially influencing calcium channels or acting as a ligand in pharmacological contexts. The compound's molecular structure suggests it could interact with biological systems, making it of interest in medicinal chemistry. Its specific applications and effects would depend on further studies, including pharmacodynamics and pharmacokinetics. Safety data and handling precautions should be adhered to, as with any chemical substance, to mitigate risks associated with exposure.
Formula:C15H22ClNO2
InChI:InChI=1/C15H21NO2.ClH/c1-13-7-3-4-8-15(13)18-12-14(17)11-16-9-5-2-6-10-16;/h2-5,7-8,14,17H,6,9-12H2,1H3;1H
SMILES:Cc1ccccc1OCC(CN1CC=CCC1)O.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.