CAS 6775-26-4
:Isoquinoline, 6,7-dimethoxy-1-(3,4,5-triethoxyphenyl)-, hydrochloride (1:1)
Description:
Isoquinoline, 6,7-dimethoxy-1-(3,4,5-triethoxyphenyl)-, hydrochloride (1:1) is a chemical compound characterized by its isoquinoline core structure, which is a bicyclic aromatic compound. The presence of methoxy groups at the 6 and 7 positions enhances its solubility and reactivity, while the triethoxyphenyl substituent at the 1-position contributes to its overall molecular complexity and potential biological activity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications in pharmaceuticals and research. The compound may exhibit interesting pharmacological properties due to its structural features, which can influence interactions with biological targets. Its CAS number, 6775-26-4, allows for easy identification and retrieval of information regarding its properties, synthesis, and potential uses in scientific literature. Overall, this compound represents a unique combination of isoquinoline chemistry and functionalized aromatic systems, warranting further investigation into its applications and effects.
Formula:C23H27NO5·ClH
InChI:InChI=1S/C23H27NO5.ClH/c1-6-27-20-12-16(13-21(28-7-2)23(20)29-8-3)22-17-14-19(26-5)18(25-4)11-15(17)9-10-24-22;/h9-14H,6-8H2,1-5H3;1H
InChI key:InChIKey=PWPKPIKBAPBKRA-UHFFFAOYSA-N
SMILES:O(C)C1=CC=2C(=NC=CC2C=C1OC)C3=CC(OCC)=C(OCC)C(OCC)=C3.Cl
Synonyms:- 6,7-Dimethoxy-1-(3,4,5-Triethoxyphenyl)Isoquinoline Hydrochloride (1:1)
- 6,7-Dimethoxy-1-(3,4,5-triethoxyphenyl)isoquinoline hydrochloride
- Gastrolena
- Isoquinoline, 6,7-dimethoxy-1-(3,4,5-triethoxyphenyl)-, hydrochloride
- Isoquinoline, 6,7-dimethoxy-1-(3,4,5-triethoxyphenyl)-, hydrochloride (1:1)
- Octaverine HCl
- Octaverine hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Octaverine HCl
CAS:Formula:C23H27NO5·HClColor and Shape:Pale Yellow SolidMolecular weight:397.48 36.46Octaverine hydrochloride
CAS:Octaverine hydrochloride is an isoquinoline derivative that has shown inhibition of HIV (human immunodeficiency virus) reverse transcriptase.Formula:C23H28ClNO5Color and Shape:SolidMolecular weight:433.93



