CAS 67751-14-8
:Ethyl 4-(dimethylamino)-2-oxobut-3-enoate
Description:
Ethyl 4-(dimethylamino)-2-oxobut-3-enoate, with the CAS number 67751-14-8, is an organic compound characterized by its ester functional group and a conjugated system that includes a ketone and an alkene. This compound features a dimethylamino group, which contributes to its basicity and potential reactivity in various chemical reactions, such as nucleophilic substitutions or electrophilic additions. The presence of the ethyl ester group enhances its solubility in organic solvents, making it useful in synthetic applications. Ethyl 4-(dimethylamino)-2-oxobut-3-enoate may exhibit biological activity, which can be explored in medicinal chemistry contexts. Its structure allows for potential interactions with biological targets, making it of interest in drug development. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, this compound represents a versatile building block in organic synthesis and medicinal chemistry.
Formula:C8H13NO3
InChI:InChI=1/C8H13NO3/c1-4-12-8(11)7(10)5-6-9(2)3/h5-6H,4H2,1-3H3/b6-5+
Synonyms:- 3-Butenoic Acid, 4-(Dimethylamino)-2-Oxo-, Ethyl Ester
- ethyl (3E)-4-(dimethylamino)-2-oxobut-3-enoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
ethyl (E)-4-(dimethylamino)-2-oxo-but-3-enoate
CAS:Formula:C8H13NO3Purity:97%Color and Shape:SolidMolecular weight:171.1937Ethyl 4-(dimethylamino)-2-oxobut-3-enoate
CAS:<p>Ethyl 4-(dimethylamino)-2-oxobut-3-enoate</p>Formula:C8H13NO3Purity:98%Color and Shape: solidMolecular weight:171.19g/molEthyl 4-(Dimethylamino)-2-oxobut-3-enoate
CAS:Formula:C8H13NO3Purity:97%Color and Shape:SolidMolecular weight:171.196Ethyl 4-(Dimethylamino)-2-oxobut-3-enoate
CAS:<p>Please enquire for more information about Ethyl 4-(Dimethylamino)-2-oxobut-3-enoate including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C8H13NO3Purity:Min. 95%Molecular weight:171.2 g/mol



