CAS 67752-28-7

3-Quinolinepropanoic acid

Description:

3-Quinolinepropanoic acid is an organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the pyridine ring. This substance features a propanoic acid functional group attached to the 3-position of the quinoline ring, contributing to its acidic properties. It is typically a white to off-white solid and is soluble in organic solvents, with limited solubility in water. The compound is of interest in various fields, including medicinal chemistry, due to its potential biological activities, such as antimicrobial and anti-inflammatory properties. Its molecular structure allows for interactions with biological targets, making it a candidate for drug development. Additionally, 3-Quinolinepropanoic acid may serve as a building block in the synthesis of more complex molecules. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₂H₁₁NO₂

InChI: InChI=1S/C12H11NO2/c14-12(15)6-5-9-7-10-3-1-2-4-11(10)13-8-9/h1-4,7-8H,5-6H2,(H,14,15)

InChI key: InChIKey=PDVKRIXEUOTSJQ-UHFFFAOYSA-N

SMILES: C(CC(O)=O)C1=CC2=C(N=C1)C=CC=C2

Synonyms:

• 3-Quinolinepropanoic acid
• 3-Quinolin-3-ylpropanoic acid
• 3-Quinolin-3-yl-propionic acid

3-(Quinolin-3-yl)propanoic acid

CAS: 67752-28-7

Formula: C₁₂H₁₁NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 201.2212

Ref: IN-DA0063F2

3-(Quinolin-3-yl)propanoic acid

CAS: 67752-28-7

3-(Quinolin-3-yl)propanoic acid

Purity: 98%

Molecular weight: 201.22g/mol

Ref: 54-OR1001155

3-(QUINOLIN-3-YL)PROPANOIC ACID

CAS: 67752-28-7

Formula: C₁₂H₁₁NO₂

Purity: 98%

Molecular weight: 201.225

Ref: 10-F538380

3-(Quinolin-3-yl)propanoic acid

CAS: 67752-28-7

3-(Quinolin-3-yl)propanoic acid is an antihyperglycemic drug that has been shown to have an antihyperglycemic effect in rats. It was found to inhibit the activity of propionic acid, a precursor of glucose, and also reduced the levels of glucose in the blood. 3-(Quinolin-3-yl)propanoic acid is an intermediate in the synthesis of other drugs such as ampicillin and cefuroxime.

Formula: C₁₂H₁₁NO₂

Purity: Min. 95%

Molecular weight: 201.22 g/mol

Ref: 3D-SCA75228