CAS 67752-29-8

4-Quinolinepropanoic acid

Description:

4-Quinolinepropanoic acid, with the CAS number 67752-29-8, is an organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a propanoic acid functional group attached to the 4-position of the quinoline ring, contributing to its acidic properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The compound is of interest in various fields, including medicinal chemistry, where it may serve as a scaffold for the development of pharmaceuticals. Its potential biological activities can be attributed to the quinoline moiety, which is known for its diverse pharmacological effects. Additionally, 4-Quinolinepropanoic acid may participate in various chemical reactions, making it a valuable intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₂H₁₁NO₂

InChI: InChI=1S/C12H11NO2/c14-12(15)6-5-9-7-8-13-11-4-2-1-3-10(9)11/h1-4,7-8H,5-6H2,(H,14,15)

InChI key: InChIKey=IWJZVWBVDNIJIL-UHFFFAOYSA-N

SMILES: C(CC(O)=O)C=1C2=C(N=CC1)C=CC=C2

Synonyms:

• 3-Quinolin-4-yl-propionic acid
• 4-Quinolinepropanoic Acid
• NSC 100032
• 3-(Quinolin-4-yl)propanoic acid

3-(Quinolin-4-yl)propanoic acid

CAS: 67752-29-8

3-(Quinolin-4-yl)propanoic acid

Purity: 97%

Molecular weight: 201.22g/mol

Ref: 54-OR1036392

3-(Quinolin-4-yl)propanoic acid

CAS: 67752-29-8

Purity: 97%

Molecular weight: 201.2250061

Ref: 10-F673704

3-(Quinolin-4-yl)propanoic acid

CAS: 67752-29-8

Versatile small molecule scaffold

Formula: C₁₂H₁₁NO₂

Purity: Min. 95%

Molecular weight: 201.22 g/mol

Ref: 3D-SCA75229