CAS 67752-30-1

3-Quinolinemethanol, α-methyl-

Description:

3-Quinolinemethanol, α-methyl- is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. This compound features a hydroxymethyl group (-CH2OH) attached to the quinoline ring, along with a methyl group (–CH3) at the alpha position relative to the hydroxymethyl group. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the hydroxymethyl group contributes to its potential solubility in polar solvents, while the aromatic nature of the quinoline structure may impart some degree of hydrophobicity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its properties, such as melting point, boiling point, and reactivity, can vary based on the specific conditions and purity of the sample. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.

Formula: C₁₁H₁₁NO

InChI: InChI=1S/C11H11NO/c1-8(13)10-6-9-4-2-3-5-11(9)12-7-10/h2-8,13H,1H3

InChI key: InChIKey=SKBHMOHCXMUCPS-UHFFFAOYSA-N

SMILES: C(C)(O)C1=CC2=C(N=C1)C=CC=C2

Synonyms:

• 1-Quinolin-3-yl-ethanol
• α-Methyl-3-quinolinemethanol
• 3-Quinolinemethanol, α-methyl-
• 1-(Quinolin-3-yl)ethan-1-ol

1-(QUINOLIN-3-YL)ETHAN-1-OL

CAS: 67752-30-1

Formula: C₁₁H₁₁NO

Purity: 95.0%

Molecular weight: 173.215

Ref: 10-F534165

1-(Quinolin-3-yl)ethan-1-ol

CAS: 67752-30-1

Versatile small molecule scaffold

Formula: C₁₁H₁₁NO

Purity: Min. 95%

Molecular weight: 173.21 g/mol

Ref: 3D-SCA75230