CAS 677713-46-1
:4-(2-chlorophenyl)-6-methyl-1H-thieno[2,3-d]pyrimidin-2-one
Description:
4-(2-Chlorophenyl)-6-methyl-1H-thieno[2,3-d]pyrimidin-2-one, with the CAS number 677713-46-1, is a heterocyclic compound characterized by its thieno[2,3-d]pyrimidine core structure, which incorporates both sulfur and nitrogen atoms. This compound features a 2-chlorophenyl group and a methyl group at specific positions, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the chlorine atom can influence its reactivity and biological activity, potentially enhancing its pharmacological properties. Compounds of this class are often investigated for their potential as pharmaceuticals, particularly in the fields of oncology and infectious diseases, due to their ability to interact with biological targets. The thieno[2,3-d]pyrimidine framework is known for its diverse biological activities, making this compound of interest in medicinal chemistry research. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C13H9ClN2OS
InChI:InChI=1/C13H9ClN2OS/c1-7-6-9-11(8-4-2-3-5-10(8)14)15-13(17)16-12(9)18-7/h2-6H,1H3,(H,15,16,17)
SMILES:Cc1cc2c(c3ccccc3Cl)nc(nc2s1)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-(2-Chlorophenyl)-6-methylthieno[2,3-d]pyrimidin-2(1H)-one
CAS:Controlled Product<p>Applications A thienopyrimidine derivative as herbicides.<br>References Kourounakis, A., et al.: Drug Dev. Res., 2000, 49(4), 227 (2000),<br></p>Formula:C13H9ClN2OSColor and Shape:NeatMolecular weight:276.74
