CAS 677728-92-6
:2-Fluoropyridine-5-carboxaldehyde
Description:
2-Fluoropyridine-5-carboxaldehyde is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a fluorine atom at the second position and an aldehyde functional group at the fifth position distinguishes this compound. It typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. This compound is known for its reactivity due to the aldehyde group, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. Additionally, the fluorine substituent can influence the electronic properties of the molecule, potentially enhancing its reactivity in certain contexts. 2-Fluoropyridine-5-carboxaldehyde is utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, owing to its ability to serve as a building block for more complex molecules. Safety data should be consulted, as with any chemical, to ensure proper handling and usage in laboratory settings.
Formula:C6H4FNO
InChI:InChI=1/C6H4FNO/c7-6-2-1-5(4-9)3-8-6/h1-4H
SMILES:c1cc(F)ncc1C=O
Synonyms:- 3-Pyridinecarboxaldehyde, 6-Fluoro-
- 6-Fluoronicotinaldehyde
- 6-Fluoropyridine-3-Carbaldehyde
- 2-Fluoropyridine-5-carbaldehyde
- 2-Fluoro-5-formylpyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ref: IN-DA003663
1kgTo inquire500gTo inquire250mg25.00€1g27.00€5g61.00€10g95.00€25g180.00€50g250.00€100g619.00€6-Fluoronicotinaldehyde
CAS:6-FluoronicotinaldehydeFormula:C6H4FNOPurity:98%Color and Shape: white fused solidMolecular weight:125.10g/mol2-Fluoropyridine-5-carboxaldehyde
CAS:2-Fluoropyridine-5-carboxaldehyde is a reactive chemical that can be used as an acceptor in organic synthesis. It has been shown to have antibacterial properties, and is also a synthon for the production of prosthetic groups. 2-Fluoropyridine-5-carboxaldehyde reacts with dopamine to form diphenyl ethers, which are used as labels for immunoassays. This chemical can be catalysed and has been shown to be resistant to catalysis. 2-Fluoropyridine-5-carboxaldehyde can also be used in the synthesis of cycloalkanes.Formula:C6H4FNOPurity:Min. 95%Molecular weight:125.1 g/mol



