CAS 67792-82-9

2-(1H-imidazol-2-yl)benzoic acid

Description:

2-(1H-imidazol-2-yl)benzoic acid, also known by its CAS number 67792-82-9, is an organic compound characterized by the presence of both an imidazole ring and a benzoic acid moiety. This compound features a benzoic acid group, which is a carboxylic acid attached to a benzene ring, and an imidazole group, a five-membered aromatic ring containing two nitrogen atoms. The presence of the imidazole ring imparts unique properties, such as potential biological activity and the ability to participate in hydrogen bonding and coordination with metal ions. This compound may exhibit acidic behavior due to the carboxylic acid functional group, making it soluble in polar solvents. Its structural characteristics suggest potential applications in pharmaceuticals, particularly in drug design, where imidazole derivatives are often explored for their biological activities. Additionally, the compound may serve as a ligand in coordination chemistry, interacting with various metal centers. Overall, 2-(1H-imidazol-2-yl)benzoic acid is a versatile compound with significant implications in both medicinal chemistry and materials science.

Formula: C₁₀H₈N₂O₂

InChI: InChI=1/C10H8N2O2/c13-10(14)8-4-2-1-3-7(8)9-11-5-6-12-9/h1-6H,(H,11,12)(H,13,14)

SMILES: c1ccc(c(c1)c1ncc[nH]1)C(=O)O

Synonyms:

• benzoic acid, 2-(1H-imidazol-2-yl)-

2-(1H-IMIDAZOL-2-YL)-BENZOIC ACID

CAS: 67792-82-9

Formula: C₁₀H₈N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 188.1827

Ref: IN-DA00FD42

2-(1H-imidazol-2-yl)benzoic acid

CAS: 67792-82-9

2-(1H-imidazol-2-yl)benzoic acid

Purity: 98%

Ref: 54-OR1042379

2-(1H-Imidazol-2-yl)benzoic acid

CAS: 67792-82-9

Formula: C₁₀H₈N₂O₂

Purity: 98%

Molecular weight: 188.186

Ref: 10-F234408

2-(2-Carboxyphenyl)imidazole

Controlled Product

CAS: 67792-82-9

Applications 2-(1H-imidazol-2-yl)benzoic acid (cas# 67792-82-9) is a useful research chemical.

Formula: C₁₀H₈N₂O₂

Color and Shape: Neat

Molecular weight: 188.183

Ref: TR-I386033